|
CAS#: 97136-66-8 Product: 4-[(E)-2-(4-Methylphenyl)Ethenyl]Aniline No suppilers available for the product. |
| Name | 4-[(E)-2-(4-Methylphenyl)Ethenyl]Aniline |
|---|---|
| Synonyms | 4-[(E)-2-(4-Methylphenyl)Vinyl]Aniline; [4-[(E)-2-(4-Methylphenyl)Vinyl]Phenyl]Amine; 3-12-00-03320 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 |
| CAS Registry Number | 97136-66-8 |
| SMILES | C1=CC(=CC=C1C)\C=C\C2=CC=C(C=C2)N |
| InChI | 1S/C15H15N/c1-12-2-4-13(5-3-12)6-7-14-8-10-15(16)11-9-14/h2-11H,16H2,1H3/b7-6+ |
| InChIKey | IYLUPPNUGBEWFI-VOTSOKGWSA-N |
| Density | 1.095g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.416°C at 760 mmHg (Cal.) |
| Flash point | 195.284°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(E)-2-(4-Methylphenyl)Ethenyl]Aniline |