|
CAS#: 97337-98-9 Product: 1,1-Dimethylindan-5,6-Diol No suppilers available for the product. |
| Name | 1,1-Dimethylindan-5,6-Diol |
|---|---|
| Synonyms | 1,1-Dimethylindane-5,6-Diol; 1,1-Dimethylindan-5,6-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| CAS Registry Number | 97337-98-9 |
| EINECS | 306-593-5 |
| SMILES | C1=C(O)C(=CC2=C1C(CC2)(C)C)O |
| InChI | 1S/C11H14O2/c1-11(2)4-3-7-5-9(12)10(13)6-8(7)11/h5-6,12-13H,3-4H2,1-2H3 |
| InChIKey | WITVSXXDJMKFFE-UHFFFAOYSA-N |
| Density | 1.159g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.778°C at 760 mmHg (Cal.) |
| Flash point | 152.262°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Dimethylindan-5,6-Diol |