|
CAS#: 97387-93-4 Product: Hypoestestatin 1 No suppilers available for the product. |
| Name | Hypoestestatin 1 |
|---|---|
| Synonyms | Phenanthro(9,10-G)Pyrrolo(1,2-B)Isoquinoline, 9,10,12,13,14,14A,15,16-Octahydro-2,3,6-Trimethoxy-, (S)-; (S)-9,10,12,13,14,14A,15,16-Octahydro-2,3,6-Trimethoxyphenanthro(9,10-G)Pyrrolo(1,2-B)Isoquinoline |
| Molecular Structure | ![]() |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 |
| CAS Registry Number | 97387-93-4 |
| SMILES | [C@@H]16N(CC4=C(C1)CC3=C5C(=C2C=C(C=CC2=C3C4)OC)C=C(C(=C5)OC)OC)CCC6 |
| InChI | 1S/C27H29NO3/c1-29-19-6-7-20-21-11-17-15-28-8-4-5-18(28)9-16(17)10-22(21)24-13-26(30-2)27(31-3)14-25(24)23(20)12-19/h6-7,12-14,18H,4-5,8-11,15H2,1-3H3/t18-/m0/s1 |
| InChIKey | ABHZNXWGGBGWCA-SFHVURJKSA-N |
| Density | 1.262g/cm3 (Cal.) |
|---|---|
| Boiling point | 612.318°C at 760 mmHg (Cal.) |
| Flash point | 174.021°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hypoestestatin 1 |