|
CAS#: 97465-55-9 Product: N,N'-Bis(Dimethylphenyl)Guanidine Monohydrochloride No suppilers available for the product. |
| Name | N,N'-Bis(Dimethylphenyl)Guanidine Monohydrochloride |
|---|---|
| Synonyms | N,N'-Bis(Dimethylphenyl)Guanidine Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22ClN3 |
| Molecular Weight | 303.83 |
| CAS Registry Number | 97465-55-9 |
| EINECS | 306-910-7 |
| SMILES | [H+].C2=C(NC(=NC1=CC=CC(=C1C)C)N)C(=C(C=C2)C)C.[Cl-] |
| InChI | 1S/C17H21N3.ClH/c1-11-7-5-9-15(13(11)3)19-17(18)20-16-10-6-8-12(2)14(16)4;/h5-10H,1-4H3,(H3,18,19,20);1H |
| InChIKey | RYQYLNYFIABLGA-UHFFFAOYSA-N |
| Boiling point | 440.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 220°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N'-Bis(Dimethylphenyl)Guanidine Monohydrochloride |