|
CAS#: 97552-83-5 Product: bis(2-hydroxyethyl)ammonium; 2-nitroheptanedioate No suppilers available for the product. |
| Name | bis(2-hydroxyethyl)ammonium; 2-nitroheptanedioate |
|---|---|
| Synonyms | bis[bis(2-hydroxyethyl)ammonium] nitroheptanedioate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H33N3O10 |
| Molecular Weight | 415.44 |
| CAS Registry Number | 97552-83-5 |
| EINECS | 307-135-7 |
| SMILES | OCC[NH2+]CCO.OCC[NH2+]CCO.[O-]C(=O)C(CCCCC([O-])=O)[N+]([O-])=O |
| InChI | 1S/C7H11NO6.2C4H11NO2/c9-6(10)4-2-1-3-5(7(11)12)8(13)14;2*6-3-1-5-2-4-7/h5H,1-4H2,(H,9,10)(H,11,12);2*5-7H,1-4H2 |
| InChIKey | ZHXMDHABNIPIBE-UHFFFAOYSA-N |
| Boiling point | 752.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 408.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for bis(2-hydroxyethyl)ammonium; 2-nitroheptanedioate |