|
CAS#: 97673-82-0 Product: (4R)-2,2-Dimethyl-1,3-dioxolane-4-carbonyl chloride No suppilers available for the product. |
| Name | (4R)-2,2-Dimethyl-1,3-dioxolane-4-carbonyl chloride |
|---|---|
| Synonyms | 1,3-DIOXOLANE-4-CARBONYL CHLORIDE, 2,2-DIMETHYL-, (4R)- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9ClO3 |
| Molecular Weight | 164.59 |
| CAS Registry Number | 97673-82-0 |
| SMILES | O=C(Cl)[C@@H]1OC(OC1)(C)C |
| InChI | 1S/C6H9ClO3/c1-6(2)9-3-4(10-6)5(7)8/h4H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | LFLHAXOMFLJNJK-SCSAIBSYSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 183.891°C at 760 mmHg (Cal.) |
| Flash point | 72.405°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4R)-2,2-Dimethyl-1,3-dioxolane-4-carbonyl chloride |