| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Tryptophan derivatives |
|---|---|
| Name | N-[(4-{(E)-[4-(Dimethylamino)phenyl]diazenyl}phenyl)sulfonyl]-L-tryptophan |
| Synonyms | Dabsyl-L-tryptophan |
| Molecular Structure | ![]() |
| Molecular Formula | C25H25N5O4S |
| Molecular Weight | 491.56 |
| CAS Registry Number | 97685-00-2 |
| SMILES | CN(C)c1ccc(cc1)/N=N/c2ccc(cc2)S(=O)(=O)N[C@@H](Cc3c[nH]c4c3cccc4)C(=O)O |
| InChI | 1S/C25H25N5O4S/c1-30(2)20-11-7-18(8-12-20)27-28-19-9-13-21(14-10-19)35(33,34)29-24(25(31)32)15-17-16-26-23-6-4-3-5-22(17)23/h3-14,16,24,26,29H,15H2,1-2H3,(H,31,32)/b28-27+/t24-/m0/s1 |
| InChIKey | SGKGZXUAHWJTIA-ZGGJALHESA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Melting point | 206°C (Expl.) |
| Boiling point | 766.94°C at 760 mmHg (Cal.) |
| Flash point | 417.63°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-[(4-{(E)-[4-(Dimethylamino)phenyl]diazenyl}phenyl)sulfonyl]-L-tryptophan |