Online Database of Chemicals from Around the World
|
CAS#: 97890-16-9 Product: Bis(Oxiranylmethyl) 3,4,5,6-Tetrachlorocyclohexene-1,2-Dicarboxylate No suppilers available for the product. |
| Name | Bis(Oxiranylmethyl) 3,4,5,6-Tetrachlorocyclohexene-1,2-Dicarboxylate |
|---|---|
| Synonyms | 3,4,5,6-Tetrachlorocyclohexene-1,2-Dicarboxylic Acid Bis(2-Oxiranylmethyl) Ester; 3,4,5,6-Tetrachlorocyclohexene-1,2-Dicarboxylic Acid Diglycidyl Ester; Bis(Oxiranylmethyl) 3,4,5,6-Tetrachlorocyclohexene-1,2-Dicarboxylate |
| Molecular Structure |  |
| Molecular Formula | C14H14Cl4O6 |
| Molecular Weight | 420.07 |
| CAS Registry Number | 97890-16-9 |
| EINECS | 308-196-2 |
| SMILES | C(OC(=O)C1=C(C(Cl)C(Cl)C(Cl)C1Cl)C(OCC2OC2)=O)C3OC3 |
| InChI | 1S/C14H14Cl4O6/c15-9-7(13(19)23-3-5-1-21-5)8(10(16)12(18)11(9)17)14(20)24-4-6-2-22-6/h5-6,9-12H,1-4H2 |
| InChIKey | HRRTVPCKXPJNNB-UHFFFAOYSA-N |
| Density | 1.59g/cm3 (Cal.) |
|---|---|
| Boiling point | 583.402°C at 760 mmHg (Cal.) |
| Flash point | 231.043°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Oxiranylmethyl) 3,4,5,6-Tetrachlorocyclohexene-1,2-Dicarboxylate |