|
CAS#: 98-39-5 Product: 4-Chloro-3-hydrazinobenzenesulphonic acid No suppilers available for the product. |
| Name | 4-Chloro-3-hydrazinobenzenesulphonic acid |
|---|---|
| Synonyms | 4-Chloro-3-Hydrazino-Benzenesulfonic Acid; 4-Chloro-3-Hydrazinobenzenesulfonic Acid; 4-Chloro-3-Hydrazinyl-Benzenesulfonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7ClN2O3S |
| Molecular Weight | 222.65 |
| CAS Registry Number | 98-39-5 |
| EINECS | 202-663-3 |
| SMILES | C1=C(C=C(C(=C1)Cl)NN)[S](=O)(=O)O |
| InChI | 1S/C6H7ClN2O3S/c7-5-2-1-4(13(10,11)12)3-6(5)9-8/h1-3,9H,8H2,(H,10,11,12) |
| InChIKey | WUZVUAJOSITGDK-UHFFFAOYSA-N |
| Density | 1.702g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-3-hydrazinobenzenesulphonic acid |