Online Database of Chemicals from Around the World
|
CAS#: 98640-41-6 Product: S-(1,1,2,2,3,3-Hexafluoropropyl)-L-Cysteine No suppilers available for the product. |
| Name | S-(1,1,2,2,3,3-Hexafluoropropyl)-L-Cysteine |
|---|---|
| Synonyms | (2R)-2-Amino-3-(1,1,2,2,3,3-Hexafluoropropylthio)Propanoic Acid; (2R)-2-Amino-3-(1,1,2,2,3,3-Hexafluoropropylthio)Propionic Acid; S-(1,1,2,2,3,3-Hexafluoropropyl)-L-Cysteine |
| Molecular Structure |  |
| Molecular Formula | C6H7F6NO2S |
| Molecular Weight | 271.18 |
| CAS Registry Number | 98640-41-6 |
| SMILES | [C@H](C(=O)O)(N)CSC(C(C(F)F)(F)F)(F)F |
| InChI | 1S/C6H7F6NO2S/c7-4(8)5(9,10)6(11,12)16-1-2(13)3(14)15/h2,4H,1,13H2,(H,14,15)/t2-/m0/s1 |
| InChIKey | JUZNRZOPIWAZGE-REOHCLBHSA-N |
| Density | 1.564g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.056°C at 760 mmHg (Cal.) |
| Flash point | 115.312°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for S-(1,1,2,2,3,3-Hexafluoropropyl)-L-Cysteine |