|
CAS#: 99-23-0 Product: 4,5,6-Trihydroxy-3-oxo-1,4,6-cycloheptatriene-1-carboxylic acid No suppilers available for the product. |
| Name | 4,5,6-Trihydroxy-3-oxo-1,4,6-cycloheptatriene-1-carboxylic acid |
|---|---|
| Synonyms | 1,3,6-Cyc |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6O6 |
| Molecular Weight | 198.13 |
| CAS Registry Number | 99-23-0 |
| SMILES | O=C1/C=C(\C=C(\O)C(\O)=C1\O)C(=O)O |
| InChI | 1S/C8H6O6/c9-4-1-3(8(13)14)2-5(10)7(12)6(4)11/h1-2H,(H,13,14)(H3,9,10,11,12) |
| InChIKey | RRDGXYZZWSIADF-UHFFFAOYSA-N |
| Density | 2.069g/cm3 (Cal.) |
|---|---|
| Boiling point | 206.392°C at 760 mmHg (Cal.) |
| Flash point | 92.914°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5,6-Trihydroxy-3-oxo-1,4,6-cycloheptatriene-1-carboxylic acid |