|
CAS#: 99208-91-0 Product: N(1)-Nitroso-3-Nitromethylindole No suppilers available for the product. |
| Name | N(1)-Nitroso-3-Nitromethylindole |
|---|---|
| Synonyms | 3-(Nitromethyl)-1-Nitroso-Indole; Nnnmi; 1H-Indole, 3-(Nitromethyl)-1-Nitroso- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.17 |
| CAS Registry Number | 99208-91-0 |
| SMILES | C2=C(C1=CC=CC=C1[N]2N=O)C[N+]([O-])=O |
| InChI | 1S/C9H7N3O3/c13-10-11-5-7(6-12(14)15)8-3-1-2-4-9(8)11/h1-5H,6H2 |
| InChIKey | YSDDQRUOEFOQBD-UHFFFAOYSA-N |
| Density | 1.48g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.334°C at 760 mmHg (Cal.) |
| Flash point | 194.705°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N(1)-Nitroso-3-Nitromethylindole |