|
CAS#: 99300-57-9 Product: N,N-Diethyl-6-Nitro-4H-1,3,2-Benzodioxaphosphorin-2-Amine 2-Sulfide No suppilers available for the product. |
| Name | N,N-Diethyl-6-Nitro-4H-1,3,2-Benzodioxaphosphorin-2-Amine 2-Sulfide |
|---|---|
| Synonyms | N,N-Diethyl-3-Nitro-8-Thioxo-7,9-Dioxa-8$L^{5}-Phosphabicyclo[4.4.0]Deca-1(6),2,4-Trien-8-Amine; Diethyl-(3-Nitro-8-Thioxo-7,9-Dioxa-8$L^{5}-Phosphabicyclo[4.4.0]Deca-1(6),2,4-Trien-8-Yl)Amine; 4H-1,3,2-Benzodioxaphosphorin-2-Amine, N,N-Diethyl-6-Nitro-, 2- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15N2O4PS |
| Molecular Weight | 302.28 |
| CAS Registry Number | 99300-57-9 |
| SMILES | C1=C2C(=CC=C1[N+]([O-])=O)O[P](=S)(OC2)N(CC)CC |
| InChI | 1S/C11H15N2O4PS/c1-3-12(4-2)18(19)16-8-9-7-10(13(14)15)5-6-11(9)17-18/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | RFKJUUCIILYXBE-UHFFFAOYSA-N |
| Density | 1.389g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.676°C at 760 mmHg (Cal.) |
| Flash point | 196.727°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Diethyl-6-Nitro-4H-1,3,2-Benzodioxaphosphorin-2-Amine 2-Sulfide |