|
CAS#: 99343-90-5 Product: cis-Tetrahydro-2,4-Dimethyl-4-PhenylFuran No suppilers available for the product. |
| Name | cis-Tetrahydro-2,4-Dimethyl-4-PhenylFuran |
|---|---|
| Synonyms | 2,4-Dimethyl-4-Phenyl-Tetrahydrofuran; 2,4-Dimethyl-4-Phenyltetrahydrofuran; 2,4-Dimethyl-4-Phenyl-Oxolane |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 |
| CAS Registry Number | 99343-90-5 (99343-91-6) |
| SMILES | C2=C(C1(CC(C)OC1)C)C=CC=C2 |
| InChI | 1S/C12H16O/c1-10-8-12(2,9-13-10)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | GPMLJOOQCIHFET-UHFFFAOYSA-N |
| Density | 0.967g/cm3 (Cal.) |
|---|---|
| Boiling point | 248.661°C at 760 mmHg (Cal.) |
| Flash point | 99.909°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cis-Tetrahydro-2,4-Dimethyl-4-PhenylFuran |