|
CAS#: 99453-84-6 Product: Neltenexine No suppilers available for the product. |
| Name | Neltenexine |
|---|---|
| Synonyms | N-[2,4-Dibromo-6-[[(4-Hydroxycyclohexyl)Amino]Methyl]Phenyl]-2-Thiophenecarboxamide; 4',6'-Dibromo-Alpha-((Trans-4-Hydroxycyclohexyl)Amino)-2-Thiophene-Carboxy-O-Toluidide; Neltenexine |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20Br2N2O2S |
| Molecular Weight | 488.24 |
| CAS Registry Number | 99453-84-6 |
| SMILES | C1=C(Br)C=C(C(=C1CNC2CCC(O)CC2)NC(C3=CC=CS3)=O)Br |
| InChI | 1S/C18H20Br2N2O2S/c19-12-8-11(10-21-13-3-5-14(23)6-4-13)17(15(20)9-12)22-18(24)16-2-1-7-25-16/h1-2,7-9,13-14,21,23H,3-6,10H2,(H,22,24) |
| InChIKey | SSLHKNBKUBAHJY-UHFFFAOYSA-N |
| Density | 1.693g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.457°C at 760 mmHg (Cal.) |
| Flash point | 265.539°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Neltenexine |