|
CAS#: 99473-73-1 Product: N(2)-(1-Carboxyethyl)Methionine No suppilers available for the product. |
| Name | N(2)-(1-Carboxyethyl)Methionine |
|---|---|
| Synonyms | (2R)-2-[(2-Hydroxy-1-Methyl-2-Oxo-Ethyl)Amino]-4-Methylsulfanyl-Butanoic Acid; (2R)-2-[(2-Hydroxy-1-Methyl-2-Oxoethyl)Amino]-4-(Methylthio)Butanoic Acid; (2R)-2-[(2-Hydroxy-2-Keto-1-Methyl-Ethyl)Amino]-4-(Methylthio)Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.27 |
| CAS Registry Number | 99473-73-1 |
| SMILES | [C@@H](CCSC)(C(O)=O)NC(C(O)=O)C |
| InChI | 1S/C8H15NO4S/c1-5(7(10)11)9-6(8(12)13)3-4-14-2/h5-6,9H,3-4H2,1-2H3,(H,10,11)(H,12,13)/t5?,6-/m1/s1 |
| InChIKey | FBAHJDMPCMAQDG-PRJDIBJQSA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.079°C at 760 mmHg (Cal.) |
| Flash point | 218.743°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N(2)-(1-Carboxyethyl)Methionine |