|
CAS#: 995-30-2 Product: Dithiophosphoric acid O,O-diethyl S-acetonyl ester No suppilers available for the product. |
| Name | Dithiophosphoric acid O,O-diethyl S-acetonyl ester |
|---|---|
| Synonyms | 1-(Diethoxyphosphinothioylthio)Propan-2-One; 1-(Diethoxythiophosphorylthio)Acetone; Ketothion |
| Molecular Structure | ![]() |
| Molecular Formula | C7H15O3PS2 |
| Molecular Weight | 242.29 |
| CAS Registry Number | 995-30-2 |
| SMILES | C(C(C)=O)S[P](OCC)(=S)OCC |
| InChI | 1S/C7H15O3PS2/c1-4-9-11(12,10-5-2)13-6-7(3)8/h4-6H2,1-3H3 |
| InChIKey | OPSAUVQHNICVGJ-UHFFFAOYSA-N |
| Density | 1.212g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.874°C at 760 mmHg (Cal.) |
| Flash point | 127.297°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dithiophosphoric acid O,O-diethyl S-acetonyl ester |