|
CAS#: 99570-16-8 Product: 11-Ketotetranorprostaglandin F2alpha No suppilers available for the product. |
| Name | 11-Ketotetranorprostaglandin F2alpha |
|---|---|
| Synonyms | (E)-7-[(1R,2R,5S)-5-Hydroxy-2-[(E,3S)-3-Hydroxybut-1-Enyl]-3-Oxo-Cyclopentyl]Hept-5-Enoic Acid; (E)-7-[(1R,2R,5S)-5-Hydroxy-2-[(E,3S)-3-Hydroxybut-1-Enyl]-3-Keto-Cyclopentyl]Hept-5-Enoic Acid; 11-Kt-Pgf2a |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 |
| CAS Registry Number | 99570-16-8 |
| SMILES | [C@H]1([C@H]([C@@H](O)CC1=O)C\C=C\CCCC(=O)O)\C=C\[C@@H](O)C |
| InChI | 1S/C16H24O5/c1-11(17)8-9-13-12(14(18)10-15(13)19)6-4-2-3-5-7-16(20)21/h2,4,8-9,11-14,17-18H,3,5-7,10H2,1H3,(H,20,21)/b4-2+,9-8+/t11-,12+,13+,14-/m0/s1 |
| InChIKey | JWBZMWSQFATLHH-GNVDEPTDSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.37°C at 760 mmHg (Cal.) |
| Flash point | 278.362°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Ketotetranorprostaglandin F2alpha |