|
CAS#: 99500-54-6 Product: Efetozole No suppilers available for the product. |
| Name | Efetozole |
|---|---|
| Synonyms | (- )-2-Methyl-1-(Alpha-Methylbenzyl)Imidazole.; Efetozole; Efetozole [Inn] |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 |
| CAS Registry Number | 99500-54-6 |
| SMILES | C1=CC=CC=C1C(C)[N]2C=CN=C2C |
| InChI | 1S/C12H14N2/c1-10(12-6-4-3-5-7-12)14-9-8-13-11(14)2/h3-10H,1-2H3 |
| InChIKey | CILDGVODBJAMGO-UHFFFAOYSA-N |
| Density | 1.021g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.184°C at 760 mmHg (Cal.) |
| Flash point | 137.161°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Efetozole |