|
CAS#: 99840-03-6 Product: Benzaldehyde Bis(2-Chloroethyl)Hydrazone No suppilers available for the product. |
| Name | Benzaldehyde Bis(2-Chloroethyl)Hydrazone |
|---|---|
| Synonyms | Benzaldehyde, 2,2-Bis(2-Chloroethyl)Hydrazone; Brn 2262657; Benzaldehyd-Bis-(2-Chloraethyl)-Hydrazon [German] |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14Cl2N2 |
| Molecular Weight | 245.15 |
| CAS Registry Number | 99840-03-6 |
| SMILES | C1=C(\C=N/N(CCCl)CCCl)C=CC=C1 |
| InChI | 1S/C11H14Cl2N2/c12-6-8-15(9-7-13)14-10-11-4-2-1-3-5-11/h1-5,10H,6-9H2/b14-10- |
| InChIKey | FCFRJDGDNYTPSE-UVTDQMKNSA-N |
| Density | 1.139g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.152°C at 760 mmHg (Cal.) |
| Flash point | 178.871°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzaldehyde Bis(2-Chloroethyl)Hydrazone |