| Product Name | CAS Registry Number | Molecular Formula |
|---|---|---|
| Nitrapyrin | 1929-82-4 | C6H3Cl4N |
| Nitrate ionophore VI | 1196157-85-3 | C28H60N4O4 |
| Nitrazepam | 146-22-5 | C15H11N3O3 |
| Nitrazine yellow | 5423-07-4 | C16H8N4O11S2.2Na |
| Nitrendipine | 39562-70-4 | C18H20N2O6 |
| Nitric acid | 7697-37-2 | HNO3 |
| Nitric acid-d | 13587-52-5 | DNO3 |
| Nitric acid, barium salt, reaction products with ammonia, chromic acid (H2CrO4) diammonium salt and copper(2+) dinitrate, calcined | 99328-50-4 | |
| Nitric acid butyl ester | 928-45-0 | C4H9NO3 |
| Nitric acid cadmium salt tetrahydrate | 10022-68-1 | Cd(NO3)2.4(H2O) |
| Nitric acid copper(2+) salt hydrate | 13778-31-9 | Cu(NO3)2.xH2O |
| Nitric acid mixt. with dinitrogen tetroxide (2:1) | 52583-42-3 | 2(HNO3).N2O4 |
| Nitric acid palladium salt hydrate | 207596-32-5 | Pd(NO3)2.x(H2O) |
| Nitric acid, rare earth salts | 68412-17-9 | |
| Nitric acid-sulfuric acid mixture | 51602-38-1 | |
| Nitridotrisulfuric acid tripotassium salt | 63504-30-3 | K3NO9S3 |
| Nitrilotriacetic acid | 139-13-9 | C6H9NO6 |
| Nitrilotriacetic acid trisodium salt monohydrate | 18662-53-8 | C6H6NO6.3Na.H2O |
| 2,2',2''-Nitrilotriacetonitrile | 7327-60-8 | C6H6N4 |
| 2,2',2''-Nitrilotriethanol o-nitrobenzoate | 71720-51-9 | C7H5NO4.C6H15NO3 |
| 2,2',2''-Nitrilotriethanol p-nitrobenzoate | 7394-38-9 | C7H5NO4.C6H15NO3 |
| 2,2',2''-Nitrilotris[N-(2,6-dimethylphenyl)acetamide] | 1374010-02-2 | C30H36N4O3 |
| 2,2',2''-Nitrilotris[ethanol] compd. with alpha-[2,4,6-tris(1-phenylethyl)phenyl]-omega-hydroxypoly(oxy-1,2-ethanediyl) phosphate | 105362-40-1 | C6H15NO3.x((C2H4O)nC30H30O).x(H3PO4) |
| 2,2',2''-Nitrilotris[ethanol] 2-ethylhexyl phosphate (salt) | 68189-01-5 | C8H18O.x(C6H15NO3).x(H3PO4) |
| 2,2',2''-Nitrilotrisethanol 12-hydroxyoctadecanoate (salt) | 93893-45-9 | C18H36O3.C6H15NO3 |
| 2,2',2''-Nitrilotrisethanol 6-[[(4-methylphenyl)sulfonyl]amino]hexanoate (salt) | 93981-14-7 | C13H19NO4S.C6H15NO3 |
| 2,2',2''-Nitrilotris-Ethanol nonanedioate (2:1) (salt) | 85030-05-3 | C9H16O4.2(C6H15NO3) |
| 2,2',2''-Nitrilotrisethanol octanedioate (2:1) (salt) | 85030-04-2 | C8H14O4.2(C6H15NO3) |
| [Nitrilotris(methylene)]tris-phosphonic acid pentasodium salt | 2235-43-0 | C3H7NNa5O9P3 |
| 4,4',4''-[Nitrilotris(methylene)]tris-1H-1,2,3-triazole-1-acetic acid triethyl ester | 736958-00-2 | C21H30N10O6 |
| 1,1',1''-Nitrilotris-2-propanol compd. with 2-[4-[[1-[[(2-methoxy-5-sulfophenyl)amino]carbonyl]-2-oxopropyl]azo]phenyl]-6-methyl-7-benzothiazolesulfonic acid sodium salt | 85392-18-3 | C25H22N4O9S3.C9H21NO3.x(Na) |
| 5-Nitroacenaphthene | 602-87-9 | C12H9NO2 |
| Nitroacetaldehyde diethyl acetal | 34560-16-2 | C6H13NO4 |
| Nitroacetaldehyde dimethyl acetal | 69425-53-2 | C4H9NO4 |
| 4'-Nitroacetanilide | 104-04-1 | C8H8N2O3 |
| 3'-Nitroacetanilide | 122-28-1 | C8H8N2O3 |
| Nitroacetonitrile | 13218-13-8 | C2H2N2O2 |
| 3'-Nitroacetophenone | 121-89-1 | C8H7NO3 |
| 4'-Nitroacetophenone | 100-19-6 | C8H7NO3 |
| 2'-Nitroacetophenone | 577-59-3 | C8H7NO3 |
| 2-Nitroacetophenone | 614-21-1 | C8H7NO3 |
| 1-Nitroadamantane | 7575-82-8 | C10H15NO2 |
| 4-Nitro-1-aminoanthraquinone-2-carboxylic acid | 2058-02-8 | C15H8N2O6 |
| 2-Nitro-4-aminodiphenylamine | 2784-89-6 | C12H11N3O2 |
| 2-Nitroaminoimidazoline | 5465-96-3 | C3H6N4O2 |
| 4-Nitro-4'-aminostilbene-2,2'-disulfonic acid | 119-72-2 | C14H12N2O8S2 |
| 2-Nitro-3-aminothiophene | 52003-20-0 | C4H4N2O2S |
| 2-Nitroaniline | 88-74-4 | C6H6N2O2 |
| 3-Nitroaniline | 99-09-2 | C6H6N2O2 |
| 4-Nitroaniline | 100-01-6 | C6H6N2O2 |