| LKT Laboratories, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (888) 558-5227 | |||
![]() |
peacerli@mbolin-lktlabs.com | |||
| Chemical manufacturer | ||||
| Classification | API >> Antineoplastic agents |
|---|---|
| Name | ARQ 197 |
| Synonyms | (3R,4R)-3-(5,6-Dihydro-4H-pyrrolo[3,2,1-ij]quinolin-1-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 |
| CAS Registry Number | 1000873-98-2 |
| EC Number | 805-160-2 |
| SMILES | C1CC2=C3C(=CC=C2)C(=CN3C1)[C@H]4[C@@H](C(=O)NC4=O)C5=CNC6=CC=CC=C65 |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.797, Calc.* |
| Boiling Point | 716.0±60.0 ºC (760 mmHg), Calc.* |
| Flash Point | 386.8±32.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H360-H373 Details |
| Precautionary Statements | P203-P260-P280-P318-P319-P405-P501 Details |
| Market Analysis Reports |
| List of Reports Available for ARQ 197 |