| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Epi Lovastatin-d3 |
|---|---|
| Synonyms | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2R)-2-(trideuteriomethyl)butanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.54 |
| CAS Registry Number | 1002345-93-8 |
| SMILES | [2H]C([2H])([2H])[C@H](CC)C(=O)O[C@H]1C[C@H](C=C2[C@H]1[C@H]([C@H](C=C2)C)CC[C@@H]3C[C@H](CC(=O)O3)O)C |
| Solubility | 2.137 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.532, Calc.* |
| Melting point | 197.75 ºC |
| Boiling Point | 510.59 ºC, 559.2±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 185.3±23.6 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302 Details |
| Precautionary Statements | P264-P301+P312 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Epi Lovastatin-d3 |