| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13651600618 +86 (21) 5679-5779 | |||
![]() |
sales7777@worldyachem.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 13651600618 | |||
![]() |
WhatsApp: +86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| chemBlink premium supplier since 2023 | ||||
| Classification | Chemical reagent >> Silane reagent |
|---|---|
| Name | Triethoxy(1H,1H,2H,2H-nonafluorohexyl)silane |
| Synonyms | Triethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
| Molecular Structure | ![]() |
| Molecular Formula | C12H19F9O3Si |
| Molecular Weight | 410.35 |
| CAS Registry Number | 102390-98-7 |
| EC Number | 600-308-0 |
| SMILES | CCO[Si](CCC(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(OCC)OCC |
| Solubility | 0.117 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.360, Calc.* |
| Melting point | 23.79 ºC |
| Boiling Point | 205.26 ºC, 241.5±40.0 ºC (760 mmHg), Calc.* |
| Flash Point | 99.8±27.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319 Details | ||||||||||||||||
| Precautionary Statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Triethoxy(1H,1H,2H,2H-nonafluorohexyl)silane |