| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-Chloropyridine-2-sulfonyl chloride |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C5H3Cl2NO2S |
| Molecular Weight | 212.05 |
| CAS Registry Number | 1060809-16-6 |
| SMILES | C1=CN=C(C=C1Cl)S(=O)(=O)Cl |
| Density | 1.6±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.569, Calc.* |
| Boiling Point | 316.6±27.0 ºC (760 mmHg), Calc.* |
| Flash Point | 145.3±23.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 4-Chloropyridine-2-sulfonyl chloride |