| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3-Chloropyridine-2-sulfonyl chloride |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C5H3Cl2NO2S |
| Molecular Weight | 212.05 |
| CAS Registry Number | 1186049-79-5 |
| SMILES | C1=CC(=C(N=C1)S(=O)(=O)Cl)Cl |
| Density | 1.6±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.569, Calc.* |
| Boiling Point | 308.3±27.0 ºC (760 mmHg), Calc.* |
| Flash Point | 140.3±23.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H314-H290 Details |
| Precautionary Statements | P501-P260-P234-P264-P280-P390-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P406-P405 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 3-Chloropyridine-2-sulfonyl chloride |