| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Imipramine-d3 |
|---|---|
| Synonyms | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methyl-N-(trideuteriomethyl)propan-1-amine |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 283.43 |
| CAS Registry Number | 112898-42-7 |
| EC Number | 959-395-1 |
| SMILES | [2H]C([2H])([2H])N(C)CCCN1C2=CC=CC=C2CCC3=CC=CC=C31 |
| Density | 1.0±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.575, Calc.* |
| Melting point | 140.91 ºC |
| Boiling Point | 382.05 ºC, 403.1±44.0 ºC (760 mmHg), Calc.* |
| Flash Point | 179.7±16.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Classification | |||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| |||||||||||||
| Market Analysis Reports |
| List of Reports Available for Imipramine-d3 |