| Guangzhou Lanning Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15813355568 | |||
![]() |
lanningsale@sina.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 15813355568 | |||
![]() |
WhatsApp: +8615813355568 | |||
| Chemical manufacturer since 2022 | ||||
| chemBlink standard supplier since 2023 | ||||
| Classification | API >> Antibiotics >> Beta-lactamase inhibitor |
|---|---|
| Name | Imipenem EP Impurity A |
| Synonyms | Thienamycin;(5R,6S)-3-(2-aminoethylsulfanyl)-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.32 |
| CAS Registry Number | 59995-64-1 |
| SMILES | C[C@H]([C@@H]1[C@H]2CC(=C(N2C1=O)C(=O)O)SCCN)O |
| Solubility | 3.417e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.663, Calc.* |
| Melting point | 308.00 ºC |
| Boiling Point | 507.17 ºC, 514.0±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 264.7±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Imipenem EP Impurity A |