| Clearsynth Canada | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (415) 685-4395 | |||
![]() |
enquiry@clearsynth.com | |||
| Chemical manufacturer since 2010 | ||||
| chemBlink standard supplier since 2013 | ||||
| Name | N-Nitroso-N-methyl-4-aminobutyric Acid-d3 |
|---|---|
| Synonyms | 4-[nitroso(trideuteriomethyl)amino]butanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C5D3H7N2O3 |
| Molecular Weight | 149.16 |
| CAS Registry Number | 1184996-41-5 |
| SMILES | [2H]C([2H])([2H])N(CCCC(=O)O)N=O |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.498, Calc.* |
| Boiling Point | 364.0±25.0 ºC (760 mmHg), Calc.* |
| Flash Point | 173.9±23.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for N-Nitroso-N-methyl-4-aminobutyric Acid-d3 |