Online Database of Chemicals from Around the World

(R)-9-hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-one
[CAS 1190363-44-0]

List of Suppliers
Zhejiang Chempharm Industry&trading Co., Ltd. China
www.chempharm.cn
+86 (571) 8770-1568
export@chempharm.cn
Chemical distributor since 1996
chemBlink Standard supplier since 2007

Identification
ClassificationPharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound >> Ketones
Name(R)-9-hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-one
Synonyms(9R)-9-hydroxy-6,7,8,9-tetrahydrocyclohepta[b]pyridin-5-one
Molecular Structure(R)-9-hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-one molecular structure (CAS 1190363-44-0)
Molecular FormulaC10H11NO2
Molecular Weight177.20
CAS Registry Number1190363-44-0
SMILESC1C[C@H](C2=C(C=CC=N2)C(=O)C1)O
Properties
Density1.3±0.1 g/cm3, Calc.*
Index of Refraction1.590, Calc.*
Boiling Point358.8±30.0 °C (760 mmHg), Calc.*
Flash Point170.8±24.6 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319-H335  Details
Safety StatementsP261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501  Details
SDSAvailable
up chemBlink Chemical Story
(R)-9-Hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-one is a fascinating compound that has attracted the attention of researchers due to its unique structure and potential applications in pharmaceutical and chemical research. The discovery of (R)-9-Hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-one stems from the exploration of cyclic compounds with potential biological activity. Researchers aim to synthesize new molecules that can serve as leads for drug discovery. The structure of the compound has a hydroxyl group, a tetrahydrocycloheptane ring fused to the pyridinone moiety, and chirality at the 9th position, making it particularly valuable in pharmacological research. The compound was synthesized through a series of organic reactions, starting from simpler precursors and utilizing asymmetric synthesis techniques to achieve the desired (R)-enantiomer.

The molecular formula of (R)-9-Hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-one is C11H13NO2. Its molecular weight is 191.23 g/mol. The compound exhibits several important properties. The presence of a chiral center at position 9 increases its specificity in biological interactions. The hydroxyl group at position 9 enhances its reactivity and potential for hydrogen bonding, affecting its solubility and interaction with biological targets. The fused cycloheptane and pyridone rings contribute to the structural rigidity and potential biological activity of the compound.

The main application of (R)-9-hydroxy-6,7,8,9-tetrahydro-5H-cycloheptano[b]pyridin-5-one is pharmaceutical. The unique structure and chirality of the compound make it a promising candidate for drug development. It has potential applications in the treatment of neurological diseases due to its ability to interact with specific neurotransmitter receptors. In addition, its structural framework can be used as a scaffold for the design of new drugs for various diseases, including cancer and inflammation.

In chemical research, the compound is valuable for studying reaction mechanisms and developing new synthetic methods. Its unique structure enables chemists to explore various functional group transformations and stereoselective reactions. This compound can serve as a model for understanding the behavior of similar fused ring systems and their reactivity, thus advancing organic chemistry.

The synthesis of (R)-9-hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-one involves an asymmetric synthesis, making it a useful compound for studying chiral and enantioselective reactions. Researchers can use this compound to develop and improve techniques for producing chiral molecules, which is essential for the pharmaceutical industry to make drugs with specific biological activities.

Although less explored, the unique structure of this compound suggests its potential applications in materials science. It can be used to develop new materials with specific properties, such as optical activity or specific interactions with other compounds. Research into its materials science applications is ongoing and may reveal more uses in the future.

The future of (R)-9-hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-one lies in its continued exploration through research and development. Understanding its full biological activity, chemical reactivity, and potential applications is essential for its further application. Innovations in synthetic methods and derivative development are expected to improve its efficacy and broaden its applications in various fields.

References

2012. Synthesis of the CGRP Receptor Antagonist BMS-846372. Synfacts.
DOI: 10.1055/s-0032-1317565
Market Analysis Reports
Related Products
3a-Hydroxy-3,3a...  10-Hydroxy-7,8,...  3-Hydroxy-1,2,3...  11-Hydroxy-delt...  8-Hydroxy-delta...  4'-Hydroxy-delt...  3'-Hydroxy-delt...  2'-Hydroxy-delt...  5-Hydroxy-2,3,4...  3-Hydroxy-8,9,1...  2-Hydroxytetrah...  14-Hydroxy-3bet...  (2alpha(2S,3S,4...  7-Hydroxy-2,3,4...  2-Hydroxy-N-(1,...  (S)-(+)-3-Hydro...  3-Hydroxytetrah...  2-Hydroxytetrah...  (S)-(+)-3-Hydro...  (S)-(+)-3-Hydro...