| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Analytical chemistry >> Analytical reagent >> Ion chromatography reagent |
|---|---|
| Name | Sulfamethoxazole-13C6 |
| Synonyms | 4-amino-N-(5-methyl-1,2-oxazol-3-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 259.23 |
| CAS Registry Number | 1196157-90-0 |
| EC Number | 689-544-3 |
| SMILES | CC1=CC(=NO1)NS(=O)(=O)[13C]2=[13CH][13CH]=[13C]([13CH]=[13CH]2)N |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.641, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H317-H319-H335-H361 Details | ||||||||||||||||||||||||
| Precautionary Statements | P201-P202-P261-P264-P271-P272-P280-P302+P352-P304+P340+P312-P305+P351+P338-P308+P313-P333+P313-P337+P313-P362-P403+P233-P405-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Sulfamethoxazole-13C6 |