| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Classification | Analytical chemistry >> Standard >> Pharmacopoeia standards and magazine standards |
|---|---|
| Name | Sulfamethoxazole EP Impurity F |
| Synonyms | Isosulfamethoxazole;4-amino-N-(3-methyl-1,2-oxazol-5-yl)benzenesulfonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 |
| CAS Registry Number | 17103-52-5 |
| SMILES | CC1=NOC(=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
| Solubility | 8758 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.641, Calc.* |
| Melting point | 172.43 ºC |
| Boiling Point | 414.01 ºC, 479.2±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 243.6±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Sulfamethoxazole EP Impurity F |