| Tianjin Zhongxin Chem-tech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (22) 6688-0623 | |||
![]() |
sales@tjzxchem.com | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2009 | ||||
| Classification | Organic raw materials >> Organic phosphine compound |
|---|---|
| Name | P-Cyclohexyl-P-methylphosphinic acid aluminum salt |
| Synonyms | Cyclohexyl(methyl)phosphinic acid - aluminium (3:1) |
| Molecular Structure | ![]() |
| Molecular Formula | 3(C7H14O2P).Al |
| Molecular Weight | 510.46 |
| CAS Registry Number | 1247079-94-2 |
| SMILES | C1C(CCCC1)[P](=O)(C)O[Al](O[P](C2CCCCC2)(C)=O)O[P](C3CCCCC3)(C)=O |
|
P-Cyclohexyl-P-methylphosphinic acid aluminum salt is an organophosphorus compound characterized by the presence of both cyclohexyl and methyl groups attached to a phosphinic acid moiety. Its chemical formula can be denoted as C11H19AlO3P, reflecting its complex structure that includes an aluminum salt and phosphinic acid functionalities. This compound has garnered interest due to its unique properties and potential applications in various industrial and chemical processes. The discovery of p-cyclohexyl-p-methylphosphinic acid aluminum salt is rooted in the exploration of phosphorus-based compounds, which have been extensively studied since the early 20th century for their diverse reactivity and applications. Researchers began synthesizing phosphinic acids and their derivatives in the mid-1900s, leading to the identification of compounds with improved stability and reactivity. P-Cyclohexyl-P-methylphosphinic acid aluminum salt was developed through the combination of phosphinic acid chemistry and aluminum salt formation, yielding a compound with enhanced properties for specific applications. One of the primary applications of p-cyclohexyl-p-methylphosphinic acid aluminum salt is in the field of flame retardants. Its phosphinic acid component contributes to flame-retardant properties by promoting char formation when exposed to heat, thereby reducing flammability. This characteristic makes it valuable in the manufacturing of materials that require enhanced fire safety, such as polymers, textiles, and coatings. The aluminum salt form further enhances its effectiveness as a flame retardant due to its ability to release water vapor upon decomposition, which helps cool the surrounding material and suppress flames. In addition to its role as a flame retardant, p-cyclohexyl-p-methylphosphinic acid aluminum salt has also been explored for its potential as a catalyst in various chemical reactions. Its unique structure allows it to participate in reactions involving the activation of electrophiles and nucleophiles, making it useful in organic synthesis. The compound can facilitate reactions such as esterification, transesterification, and Michael additions, contributing to the development of more efficient synthetic pathways for various organic compounds. Moreover, the compound has applications in the agricultural sector, particularly as a plant growth regulator. Research has shown that phosphinic acid derivatives can enhance the growth and development of plants by promoting root formation and improving nutrient uptake. P-Cyclohexyl-P-methylphosphinic acid aluminum salt, in particular, has been investigated for its ability to stimulate plant growth and increase resistance to environmental stressors, making it a valuable tool in modern agriculture. The synthesis of p-cyclohexyl-p-methylphosphinic acid aluminum salt typically involves the reaction of p-cyclohexyl-p-methylphosphinic acid with aluminum salts, resulting in the formation of the aluminum salt form of the phosphinic acid. This process highlights the significance of coordination chemistry in creating compounds that exhibit enhanced properties for specific applications. Safety considerations are essential when handling p-cyclohexyl-p-methylphosphinic acid aluminum salt, as with any organophosphorus compound. Proper personal protective equipment (PPE) should be utilized to prevent exposure, and appropriate storage conditions should be maintained to ensure stability. In conclusion, p-cyclohexyl-p-methylphosphinic acid aluminum salt is a significant organophosphorus compound with diverse applications in flame retardancy, catalysis, and agriculture. Its discovery reflects the advancements in phosphorus chemistry and the continuous search for compounds with specialized functionalities. As research progresses, further exploration of this compound's potential applications is expected, contributing to innovations in materials science, organic synthesis, and agricultural practices. |
| Market Analysis Reports |
| List of Reports Available for P-Cyclohexyl-P-methylphosphinic acid aluminum salt |