| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | AC-D-2-Nal-D-4-clphe-D-3-pal |
|---|---|
| Synonyms | (2R)-2-[[(2R)-2-[[(2R)-2-acetamido-3-naphthalen-2-ylpropanoyl]amino]-3-(4-chlorophenyl)propanoyl]amino]-3-pyridin-3-ylpropanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C32H31ClN4O5 |
| Molecular Weight | 587.07 |
| CAS Registry Number | 129225-22-5 |
| SMILES | CC(=O)N[C@H](CC1=CC2=CC=CC=C2C=C1)C(=O)N[C@H](CC3=CC=C(C=C3)Cl)C(=O)N[C@H](CC4=CN=CC=C4)C(=O)O |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.636, Calc.* |
| Boiling Point | 976.2±65.0 ºC (760 mmHg), Calc.* |
| Flash Point | 544.2±34.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for AC-D-2-Nal-D-4-clphe-D-3-pal |