| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Sabizabulin |
|---|---|
| Synonyms | VERU-111; [2-(1H-indol-3-yl)-1H-imidazol-5-yl]-(3,4,5-trimethoxyphenyl)methanone |
| Molecular Structure | ![]() |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.39 |
| CAS Registry Number | 1332881-26-1 |
| EC Number | 889-539-8 |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)C2=CN=C(N2)C3=CNC4=CC=CC=C43 |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.651, Calc.* |
| Boiling Point | 688.1±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 370.0±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Sabizabulin |