| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13651600618 +86 (21) 5679-5779 | |||
![]() |
sales7777@worldyachem.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 13651600618 | |||
![]() |
WhatsApp: +86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| chemBlink premium supplier since 2023 | ||||
| Name | (+)-Sabinene |
|---|---|
| Synonyms | (1R,5R)-4-methylidene-1-propan-2-ylbicyclo[3.1.0]hexane |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.23 |
| CAS Registry Number | 2009-00-9 |
| EC Number | 808-855-9 |
| SMILES | CC(C)[C@]12CCC(=C)[C@H]1C2 |
| Solubility | 2.494 mg/L (25 ºC water) |
|---|---|
| Density | 0.9±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.484, Calc.* |
| Melting point | -21.55 ºC |
| Boiling Point | 141.81 ºC, 164.0±0.0 ºC (760 mmHg), Calc.* |
| Flash Point | 36.7±0.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H226-H302-H304-H315-H319-H335 Details | ||||||||||||
| Precautionary Statements | P210-P233-P240-P241-P242-P243-P261-P264-P264+P265-P270-P271-P280-P301+P316-P301+P317-P302+P352-P303+P361+P353-P304+P340-P305+P351+P338-P319-P321-P330-P331-P332+P317-P337+P317-P362+P364-P370+P378-P403+P233-P403+P235-P405-P501 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for (+)-Sabinene |