| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Apremilast Impurity 6 |
|---|---|
| Synonyms | N-{2-[(1R)-1-(3-Hydroxy-4-methoxyphenyl)-2-(methylsulfonyl)ethyl]-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl}acetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C20H20N2O7S |
| Molecular Weight | 432.45 |
| CAS Registry Number | 1384967-20-7 |
| SMILES | C[S](C[C@H](C1=CC(O)=C(OC)C=C1)N(C(C2=CC=C3)=O)C(C2=C3NC(C)=O)=O)(=O)=O |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.651, Calc.* |
| Boiling Point | 781.7±60.0 ºC (760 mmHg), Calc.* |
| Flash Point | 426.5±32.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302+H312+H332-H315-H319 Details |
| Precautionary Statements | P261-P271-P280-P302+P352-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Apremilast Impurity 6 |