| Anqing Puhua Trading Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (556) 522-0409 | |||
![]() |
aqpuhua@163.com | |||
| Chemical manufacturer since 2002 | ||||
| chemBlink standard supplier since 2019 | ||||
| Name | Tert-butyl (2-aminophenyl)carbamate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 |
| CAS Registry Number | 146651-75-4 |
| EC Number | 625-192-9 |
| SMILES | CC(C)(C)OC(=O)NC1=CC=CC=C1N |
| Solubility | 527.7 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.583, Calc.* |
| Melting point | 95.70 ºC |
| Boiling Point | 321.74 ºC, 280.6±23.0 ºC (760 mmHg), Calc.* |
| Flash Point | 123.5±22.6 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H317 Details | ||||||||||||||||||||||||
| Precautionary Statements | P261-P264-P270-P272-P280-P301+P312+P330-P302+P352-P333+P313-P363-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Tert-butyl (2-aminophenyl)carbamate |