| Jinan Wonder Pharmtech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 18601195352 | |||
![]() |
wonderpharmtech@gmail.com | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | tert-Butyl (3-(4-aminophenoxy)propyl)carbamate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 |
| CAS Registry Number | 623562-56-1 |
| SMILES | CC(C)(C)OC(=O)NCCCOC1=CC=C(C=C1)N |
| Solubility | 109.9 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.527, Calc.* |
| Melting point | 130.94 ºC |
| Boiling Point | 370.23 ºC, 440.6±25.0 ºC (760 mmHg), Calc.* |
| Flash Point | 220.3±23.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P305+351+338-P302+352 Details |
| Market Analysis Reports |
| List of Reports Available for tert-Butyl (3-(4-aminophenoxy)propyl)carbamate |