Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 +86 18096409024 | |||
 |
info@purerechem.com | |||
 |
Skype Chat | |||
 |
QQ chat | |||
 |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Loratadine 2-Chloro Impurity |
|---|---|
| Synonyms | ethyl 4-(5,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
| Molecular Structure | ![CAS # 165739-64-0, Loratadine 2-Chloro Impurity, ethyl 4-(5,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate](/structures/165739-64-0.gif) |
| Molecular Formula | C22H22Cl2N2O2 |
| Molecular Weight | 417.33 |
| CAS Registry Number | 165739-64-0 |
| SMILES | CCOC(=O)N1CCC(=C2C3=C(CCC4=C2N=C(C=C4)Cl)C=C(C=C3)Cl)CC1 |
| Solubility | 0.0007699 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.0 g/cm3, Calc.* |
| Index of Refraction | 1.619, Calc.* |
| Melting point | 209.91 ºC |
| Boiling Point | 494.24 ºC, 554.6±0.0 ºC (760 mmHg), Calc.* |
| Flash Point | 289.2±0.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Loratadine 2-Chloro Impurity |