Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 +86 18096409024 | |||
 |
info@purerechem.com | |||
 |
Skype Chat | |||
 |
QQ chat | |||
 |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Loratadine Impurity 1 |
|---|---|
| Synonyms | 8-Chloro-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine |
| Molecular Structure | ![CAS # 38093-12-8, Loratadine Impurity 1, 8-Chloro-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine](/structures/38093-12-8.gif) |
| Molecular Formula | C14H12ClN |
| Molecular Weight | 229.7 |
| CAS Registry Number | 38093-12-8 |
| SMILES | ClC1=CC2=C(C=C1)CC3=NC=CC=C3CC2 |
| Solubility | 4.707 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.616, Calc.* |
| Melting point | 108.35 ºC |
| Boiling Point | 334.52 ºC, 336.6±42.0 ºC (760 mmHg), Calc.* |
| Flash Point | 187.7±13.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Loratadine Impurity 1 |