| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Naltrexone EP Impurity J |
|---|---|
| Synonyms | N-Cyclopropylmethylnoroxycodone |
| Molecular Structure | ![]() |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 |
| CAS Registry Number | 16617-07-5 |
| SMILES | COC1=C2C3=C(C[C@@H]4[C@]5([C@]3(CCN4CC6CC6)[C@@H](O2)C(=O)CC5)O)C=C1 |
| Solubility | 1266 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.665, Calc.* |
| Melting point | 196.50 ºC |
| Boiling Point | 465.53 ºC, 543.2±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 282.3±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Naltrexone EP Impurity J |