| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Naloxone EP Impurity G |
|---|---|
| Synonyms | Naloxone 3-Methyl Ether;(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| Molecular Structure | ![]() |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.40 |
| CAS Registry Number | 70866-64-7 |
| SMILES | COC1=C2C3=C(C[C@@H]4[C@]5([C@]3(CCN4CC=C)[C@@H](O2)C(=O)CC5)O)C=C1 |
| Solubility | 3666 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.649, Calc.* |
| Melting point | 189.75 ºC |
| Boiling Point | 451.09 ºC, 518.8±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 267.6±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Naloxone EP Impurity G |