| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (2S)-2-(dimethylamino)-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| Molecular Structure | ![]() |
| Protein Sequence | Y |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 |
| CAS Registry Number | 17350-74-2 |
| EC Number | 964-555-9 |
| SMILES | CN(C)[C@@H](CC1=CC=C(C=C1)O)C(=O)O |
| Solubility | 1.073e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.573, Calc.* |
| Melting point | 228.31 ºC |
| Boiling Point | 388.01 ºC, 372.5±37.0 ºC (760 mmHg), Calc.* |
| Flash Point | 179.1±26.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319-H335 Details | ||||||||||||||||||||
| Precautionary Statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for (2S)-2-(dimethylamino)-3-(4-hydroxyphenyl)propanoic acid |