| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | API >> Inhibitor drug |
|---|---|
| Name | ARV-825 |
| Synonyms | 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[4-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]acetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C46H47ClN8O9S |
| Molecular Weight | 923.43 |
| CAS Registry Number | 1818885-28-7 |
| SMILES | CC1=C(SC2=C1C(=N[C@H](C3=NN=C(N32)C)CC(=O)NC4=CC=C(C=C4)OCCOCCOCCOCCNC5=CC=CC6=C5C(=O)N(C6=O)C7CCC(=O)NC7=O)C8=CC=C(C=C8)Cl)C |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.701, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P280-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for ARV-825 |