| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | API >> Inhibitor drug |
|---|---|
| Name | Sisunatovir |
| Synonyms | 1'-[[5-(aminomethyl)-1-(4,4,4-trifluorobutyl)benzimidazol-2-yl]methyl]-6'-fluorospiro[cyclopropane-1,3'-indole]-2'-one |
| Molecular Structure | ![]() |
| Molecular Formula | C23H22F4N4O |
| Molecular Weight | 446.44 |
| CAS Registry Number | 1903763-82-5 |
| SMILES | C1CC12C3=C(C=C(C=C3)F)N(C2=O)CC4=NC5=C(N4CCCC(F)(F)F)C=CC(=C5)CN |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.648, Calc.* |
| Boiling Point | 651.9±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 348.0±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Sisunatovir |