3-[2-Benzyloxycarbonylamino-3-(2-carboxy-ethoxy)-2-(2-carboxy-ethoxymethyl)-propoxy]-propionic acid
[CAS# 200133-16-0]

Identification

• Classification: Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound >> Carboxylic acid
• Name: 3-[2-Benzyloxycarbonylamino-3-(2-carboxy-ethoxy)-2-(2-carboxy-ethoxymethyl)-propoxy]-propionic acid
• Synonyms: 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-(phenylmethoxycarbonylamino)propoxy]propanoic acid
• Molecular Formula: C₂₁H₂₉NO₁₁
• Molecular Weight: 471.46
• CAS Registry Number: 200133-16-0
• SMILES: C1=CC=C(C=C1)COC(=O)NC(COCCC(=O)O)(COCCC(=O)O)COCCC(=O)O

Safety Data

• Hazard Symbols: GHS07 Warning
• Hazard Statements: H315-H319
• Precautionary Statements: P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313

Discovory and Applicatios

3-[2-Benzyloxycarbonylamino-3-(2-carboxy-ethoxy)-2-(2-carboxy-ethoxymethyl)-propoxy]-propionic acid is a complex organic compound known for its structural and functional versatility, making it significant in pharmaceutical and chemical research. The substance is characterized by a combination of functional groups such as amino, carboxyl, and ether linkages, which play key roles in its reactivity and biological activity.

The discovery of such compounds typically stems from the need to develop molecules that can target specific biochemical pathways or processes. In this case, the incorporation of the benzyloxycarbonyl group (which is commonly used for protecting amines) suggests that the compound could be a key intermediate in peptide synthesis or drug development. Its multi-functional structure also indicates that it may have potential as a bioactive agent, potentially acting on enzymes or receptors involved in critical cellular functions.

In pharmaceutical applications, compounds with similar structures have been used in drug design, particularly as prodrugs or inhibitors of enzymes in metabolic pathways. The presence of multiple carboxyl groups suggests that this compound could participate in chelation chemistry, binding to metal ions or forming complexes that affect the function of specific enzymes or receptors. Additionally, the ethoxy and ethoxymethyl groups might influence the compound’s solubility, stability, and cellular uptake, which are important factors for its effectiveness as a therapeutic agent.

Given its structural complexity, 3-[2-Benzyloxycarbonylamino-3-(2-carboxy-ethoxy)-2-(2-carboxy-ethoxymethyl)-propoxy]-propionic acid might be of particular interest in the synthesis of bioactive molecules that can modulate cellular processes. For example, it may be used in the development of molecules aimed at treating metabolic disorders, cancer, or inflammatory diseases, where selective inhibition of enzyme activities or receptor interactions is crucial.

Moreover, this compound could find application in chemical research where it serves as a building block for the synthesis of more complex molecules with specific biological activities. The design of such compounds often involves fine-tuning their chemical structure to optimize interaction with biological targets, making substances like 3-[2-Benzyloxycarbonylamino-3-(2-carboxy-ethoxy)-2-(2-carboxy-ethoxymethyl)-propoxy]-propionic acid valuable in medicinal chemistry and drug discovery.

In conclusion, while the specific applications of 3-[2-Benzyloxycarbonylamino-3-(2-carboxy-ethoxy)-2-(2-carboxy-ethoxymethyl)-propoxy]-propionic acid are yet to be fully explored, its functional groups and structural features position it as a compound of interest in the development of bioactive molecules for therapeutic use. Future studies will likely focus on elucidating its biological activity and potential as a drug candidate for treating various diseases.