| Qufu Haida Tiancheng Biochemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (537) 4531868 +86 13345174153 | |||
![]() |
qfhdtc@126.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2011 | ||||
| chemBlink standard supplier since 2020 | ||||
| Name | Methyl 4-(((2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl)amino)-2-methoxybenzoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H17NO7 |
| Molecular Weight | 335.31 |
| CAS Registry Number | 205448-64-2 |
| SMILES | CC1(OC(=O)C(=CNC2=CC(=C(C=C2)C(=O)OC)OC)C(=O)O1)C |
| Solubility | 0.03699 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.0 g/cm3, Calc.* |
| Index of Refraction | 1.607, Calc.* |
| Melting point | 204.23 ºC |
| Boiling Point | 500.86 ºC, 547.8±0.0 ºC (760 mmHg), Calc.* |
| Flash Point | 285.1±0.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-(((2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl)amino)-2-methoxybenzoate |