| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Methyl (4S)-(+)-2,2-dimethyl-1,3-dioxolane-4-acetate |
|---|---|
| Synonyms | methyl 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.19 |
| CAS Registry Number | 95422-24-5 |
| EC Number | 804-315-1 |
| SMILES | CC1(OC[C@@H](O1)CC(=O)OC)C |
| Solubility | 5264 mg/L (25 ºC water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.419, Calc.* |
| Melting point | 21.51 ºC |
| Boiling Point | 212.17 ºC, 200.0±15.0 ºC (760 mmHg), Calc.* |
| Flash Point | 76.1±20.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H315-H319-H335 Details | ||||||||||||
| Precautionary Statements | P261-P271-P280-P302-P304-P305-P313-P332-P337-P338-P340-P351-P352 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for Methyl (4S)-(+)-2,2-dimethyl-1,3-dioxolane-4-acetate |