| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | N-De-4-ethyl-2-isopropylthiazole Ritonavir N-(Thiazol-5-ylmethyl ((2S,3S)-3-Hydroxy-1,6-diphenylhexan-2-yl)carbamate) |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C32H35N |
| Molecular Weight | 433.63 |
| CAS Registry Number | 2084828-53-3 |
| SMILES | CC1=CC=C(C=C1)N2C3CCCC3C4=C2C=CC(=C4)/C=C(\C5CCCCC5)/C6=CC=CC=C6 |
| Density | 1.1±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.639, Calc.* |
| Boiling Point | 582.1±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 259.7±27.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for N-De-4-ethyl-2-isopropylthiazole Ritonavir N-(Thiazol-5-ylmethyl ((2S,3S)-3-Hydroxy-1,6-diphenylhexan-2-yl)carbamate) |